CAS 1375068-62-4 is the registry number for 1-Bromo-5-fluoro-2-isopropoxy-3-nitrobenzene, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1-bromo-5-fluoro-3-nitro-2-propan-2-yloxybenzene (CAS 1375068-62-4) is a chemical compound with the molecular formula C9H9BrFNO3 and a molecular weight of 278.07 g/mol. IUPAC name: 1-bromo-5-fluoro-3-nitro-2-propan-2-yloxybenzene. InChIKey: RTBBAMMIBRXCEE-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFNO3 |
|---|---|
| Molecular weight | 278.07 g/mol |
| IUPAC name | 1-bromo-5-fluoro-3-nitro-2-propan-2-yloxybenzene |
| InChIKey | RTBBAMMIBRXCEE-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1Br)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)