Products 369-95-9

CAS 369-95-9 is the registry number for 2-Amino-3-(3-Bromo-5-Fluoro-4-Hydroxyphenyl)Propanoic Acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-amino-3-(3-bromo-5-fluoro-4-hydroxyphenyl)propanoic acid (CAS 369-95-9) is a chemical compound with the molecular formula C9H9BrFNO3 and a molecular weight of 278.07 g/mol. IUPAC name: 2-amino-3-(3-bromo-5-fluoro-4-hydroxyphenyl)propanoic acid. InChIKey: DUZDIGZRRMKJFE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BrFNO3
Molecular weight278.07 g/mol
IUPAC name2-amino-3-(3-bromo-5-fluoro-4-hydroxyphenyl)propanoic acid
InChIKeyDUZDIGZRRMKJFE-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1F)O)Br)CC(C(=O)O)N

Computed by PubChem (NCBI)