Products 2065250-68-0
CAS 2065250-68-0 is the registry number for (2-Bromo-6-fluoro-3-methoxy-phenyl)-carbamic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl N-(2-bromo-6-fluoro-3-methoxyphenyl)carbamate (CAS 2065250-68-0) is a chemical compound with the molecular formula C9H9BrFNO3 and a molecular weight of 278.07 g/mol. IUPAC name: methyl N-(2-bromo-6-fluoro-3-methoxyphenyl)carbamate. InChIKey: YSBVDPGTUPUPFJ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFNO3 |
|---|---|
| Molecular weight | 278.07 g/mol |
| IUPAC name | methyl N-(2-bromo-6-fluoro-3-methoxyphenyl)carbamate |
| InChIKey | YSBVDPGTUPUPFJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)NC(=O)OC)Br |
Computed by PubChem (NCBI)