CAS 21752-35-2 appears in our catalog under these names: (R)-2-((1-Phenylethyl)carbamoyl)benzoic acid, 97%, (R)-(+)-N-(1-Phenylethyl)phthalamic acid, 95%, (R)–(+)–N–(α–Methylbenzyl)phthalamic Acid, (R)-2-((1-Phenylethyl)carbamoyl)benzoic acid, 97%, 97%. Offered by: Fluorochem, Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 5g, 25g, 250mg.
2-[[(1R)-1-phenylethyl]carbamoyl]benzoic acid (CAS 21752-35-2) is a chemical compound with the molecular formula C16H15NO3 and a molecular weight of 269.29 g/mol. IUPAC name: 2-[[(1R)-1-phenylethyl]carbamoyl]benzoic acid. InChIKey: VCFKXWGKKDZMPO-LLVKDONJSA-N.
| Molecular formula | C16H15NO3 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | 2-[[(1R)-1-phenylethyl]carbamoyl]benzoic acid |
| InChIKey | VCFKXWGKKDZMPO-LLVKDONJSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NC(=O)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)