CAS 1375302-47-8 is the registry number for 7-Oxo-2-phenyl-7h-[1,2,4]triazolo[5,1-b][1,3]thiazine-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 500mg.
7-oxo-2-phenyl-[1,2,4]triazolo[5,1-b][1,3]thiazine-6-carboxylic acid (CAS 1375302-47-8) is a chemical compound with the molecular formula C12H7N3O3S and a molecular weight of 273.27 g/mol. IUPAC name: 7-oxo-2-phenyl-[1,2,4]triazolo[5,1-b][1,3]thiazine-6-carboxylic acid. InChIKey: DRJDUYKDXQXQSK-UHFFFAOYSA-N.
| Molecular formula | C12H7N3O3S |
|---|---|
| Molecular weight | 273.27 g/mol |
| IUPAC name | 7-oxo-2-phenyl-[1,2,4]triazolo[5,1-b][1,3]thiazine-6-carboxylic acid |
| InChIKey | DRJDUYKDXQXQSK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN3C(=O)C(=CSC3=N2)C(=O)O |
Computed by PubChem (NCBI)