CAS 186792-87-0 is the registry number for 5-Formyl-2-((2-nitrophenyl)amino)-3-cyanothiophene. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
5-formyl-2-(2-nitroanilino)thiophene-3-carbonitrile (CAS 186792-87-0) is a chemical compound with the molecular formula C12H7N3O3S and a molecular weight of 273.27 g/mol. IUPAC name: 5-formyl-2-(2-nitroanilino)thiophene-3-carbonitrile. InChIKey: CQNFCAMNWVNZNM-UHFFFAOYSA-N.
| Molecular formula | C12H7N3O3S |
|---|---|
| Molecular weight | 273.27 g/mol |
| IUPAC name | 5-formyl-2-(2-nitroanilino)thiophene-3-carbonitrile |
| InChIKey | CQNFCAMNWVNZNM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC2=C(C=C(S2)C=O)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)