Products 218144-79-7

CAS 218144-79-7 is the registry number for 3-(3-Nitrophenyl)-5-(thiophen-2-yl)-1,2,4-oxadiazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 100g, 5g.

Structural formula: {0} (CAS {1})

3-(3-nitrophenyl)-5-thiophen-2-yl-1,2,4-oxadiazole (CAS 218144-79-7) is a chemical compound with the molecular formula C12H7N3O3S and a molecular weight of 273.27 g/mol. IUPAC name: 3-(3-nitrophenyl)-5-thiophen-2-yl-1,2,4-oxadiazole. InChIKey: SQURSOAJNRVVBR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7N3O3S
Molecular weight273.27 g/mol
IUPAC name3-(3-nitrophenyl)-5-thiophen-2-yl-1,2,4-oxadiazole
InChIKeySQURSOAJNRVVBR-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)[N+](=O)[O-])C2=NOC(=N2)C3=CC=CS3

Computed by PubChem (NCBI)