CAS 1375303-11-9 appears in our catalog under these names: Dimethyl-5-methoxypyridine-2,3-dicarboxylate, 95%, Dimethyl 5–methoxypyridine–2,3–dicarboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Dimethyl 5-methoxypyridine-2,3-dicarboxylate (CAS 1375303-11-9) is a chemical compound with the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. IUPAC name: dimethyl 5-methoxypyridine-2,3-dicarboxylate. InChIKey: PUXVJVDCCNYZIQ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | dimethyl 5-methoxypyridine-2,3-dicarboxylate |
| InChIKey | PUXVJVDCCNYZIQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(N=C1)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)