Products 1375473-02-1

CAS 1375473-02-1 is the registry number for 5-Bromo-3-(chlorosulfonyl)-2-methylbenzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

5-bromo-3-chlorosulfonyl-2-methylbenzoic acid (CAS 1375473-02-1) is a chemical compound with the molecular formula C8H6BrClO4S and a molecular weight of 313.55 g/mol. IUPAC name: 5-bromo-3-chlorosulfonyl-2-methylbenzoic acid. InChIKey: DYXQGRGSYBJEIX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrClO4S
Molecular weight313.55 g/mol
IUPAC name5-bromo-3-chlorosulfonyl-2-methylbenzoic acid
InChIKeyDYXQGRGSYBJEIX-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1S(=O)(=O)Cl)Br)C(=O)O

Computed by PubChem (NCBI)