CAS 1375473-02-1 is the registry number for 5-Bromo-3-(chlorosulfonyl)-2-methylbenzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-bromo-3-chlorosulfonyl-2-methylbenzoic acid (CAS 1375473-02-1) is a chemical compound with the molecular formula C8H6BrClO4S and a molecular weight of 313.55 g/mol. IUPAC name: 5-bromo-3-chlorosulfonyl-2-methylbenzoic acid. InChIKey: DYXQGRGSYBJEIX-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO4S |
|---|---|
| Molecular weight | 313.55 g/mol |
| IUPAC name | 5-bromo-3-chlorosulfonyl-2-methylbenzoic acid |
| InChIKey | DYXQGRGSYBJEIX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1S(=O)(=O)Cl)Br)C(=O)O |
Computed by PubChem (NCBI)