Products 849333-58-0

CAS 849333-58-0 is the registry number for 4-Bromo-3-(chlorosulfonyl)-5-methylbenzoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

4-bromo-3-chlorosulfonyl-5-methylbenzoic acid (CAS 849333-58-0) is a chemical compound with the molecular formula C8H6BrClO4S and a molecular weight of 313.55 g/mol. IUPAC name: 4-bromo-3-chlorosulfonyl-5-methylbenzoic acid. InChIKey: WKVPXUFUECCEED-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrClO4S
Molecular weight313.55 g/mol
IUPAC name4-bromo-3-chlorosulfonyl-5-methylbenzoic acid
InChIKeyWKVPXUFUECCEED-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1Br)S(=O)(=O)Cl)C(=O)O

Computed by PubChem (NCBI)