Products 474955-66-3
CAS 474955-66-3 is the registry number for 7-Bromo-2,3-dihydro-1,4-benzodioxine-6-sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
6-bromo-2,3-dihydro-1,4-benzodioxine-7-sulfonyl chloride (CAS 474955-66-3) is a chemical compound with the molecular formula C8H6BrClO4S and a molecular weight of 313.55 g/mol. IUPAC name: 6-bromo-2,3-dihydro-1,4-benzodioxine-7-sulfonyl chloride. InChIKey: JIWVNVJZJUBFFF-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO4S |
|---|---|
| Molecular weight | 313.55 g/mol |
| IUPAC name | 6-bromo-2,3-dihydro-1,4-benzodioxine-7-sulfonyl chloride |
| InChIKey | JIWVNVJZJUBFFF-UHFFFAOYSA-N |
| SMILES | C1COC2=CC(=C(C=C2O1)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)