Products 1375931-00-2
CAS 1375931-00-2 is the registry number for N,N-Bis(1-methylethyl)(1,1′-biphenyl)-3-carboxamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
3-phenyl-N,N-di(propan-2-yl)benzamide (CAS 1375931-00-2) is a chemical compound with the molecular formula C19H23NO and a molecular weight of 281.4 g/mol. IUPAC name: 3-phenyl-N,N-di(propan-2-yl)benzamide. InChIKey: DVTNUGQURIKSLR-UHFFFAOYSA-N.
| Molecular formula | C19H23NO |
|---|---|
| Molecular weight | 281.4 g/mol |
| IUPAC name | 3-phenyl-N,N-di(propan-2-yl)benzamide |
| InChIKey | DVTNUGQURIKSLR-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=CC=CC(=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)