CAS 35336-02-8 is the registry number for N-(2,6-Bis(1-methylethyl)phenyl)benzamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
N-[2,6-di(propan-2-yl)phenyl]benzamide (CAS 35336-02-8) is a chemical compound with the molecular formula C19H23NO and a molecular weight of 281.4 g/mol. IUPAC name: N-[2,6-di(propan-2-yl)phenyl]benzamide. InChIKey: QUYJZFJRIXLNBQ-UHFFFAOYSA-N.
| Molecular formula | C19H23NO |
|---|---|
| Molecular weight | 281.4 g/mol |
| IUPAC name | N-[2,6-di(propan-2-yl)phenyl]benzamide |
| InChIKey | QUYJZFJRIXLNBQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)