CAS 77924-52-8 is the registry number for Rel-(1R,2R)-2-(dibenzylamino)cyclopentan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,2R)-2-(dibenzylamino)cyclopentan-1-ol (CAS 77924-52-8) is a chemical compound with the molecular formula C19H23NO and a molecular weight of 281.4 g/mol. IUPAC name: trans-(1R,2R)-2-(dibenzylamino)cyclopentan-1-ol. InChIKey: XCIJQGOMBGCEDC-RTBURBONSA-N.
| Molecular formula | C19H23NO |
|---|---|
| Molecular weight | 281.4 g/mol |
| IUPAC name | trans-(1R,2R)-2-(dibenzylamino)cyclopentan-1-ol |
| InChIKey | XCIJQGOMBGCEDC-RTBURBONSA-N |
| SMILES | C1C[C@H]([C@@H](C1)O)N(CC2=CC=CC=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)