CAS 1376357-98-0 appears in our catalog under these names: 1-Cyclohexyl-2,2,2-trifluoroethylamine hydrochloride, 98+%, 1-Cyclohexyl-2,2,2-trifluoroethan-1-amine hydrochloride, 95%, 1-Cyclohexyl-2,2,2-trifluoroethan-1-amine hydrochloride. Offered by: AmBeed, Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 2,5g.
1-cyclohexyl-2,2,2-trifluoroethanamine;hydrochloride (CAS 1376357-98-0) is a chemical compound with the molecular formula C8H15ClF3N and a molecular weight of 217.66 g/mol. IUPAC name: 1-cyclohexyl-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: CERGJGMILXAJNN-UHFFFAOYSA-N.
| Molecular formula | C8H15ClF3N |
|---|---|
| Molecular weight | 217.66 g/mol |
| IUPAC name | 1-cyclohexyl-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | CERGJGMILXAJNN-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)