CAS 2564735-97-1 is the registry number for (R)-1-Cyclohexyl-2,2,2-trifluoroethanamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
(1R)-1-cyclohexyl-2,2,2-trifluoroethanamine;hydrochloride (CAS 2564735-97-1) is a chemical compound with the molecular formula C8H15ClF3N and a molecular weight of 217.66 g/mol. IUPAC name: (1R)-1-cyclohexyl-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: CERGJGMILXAJNN-OGFXRTJISA-N.
| Molecular formula | C8H15ClF3N |
|---|---|
| Molecular weight | 217.66 g/mol |
| IUPAC name | (1R)-1-cyclohexyl-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | CERGJGMILXAJNN-OGFXRTJISA-N |
| SMILES | C1CCC(CC1)[C@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)