CAS 1823577-84-9 appears in our catalog under these names: 2,5-Dimethyl-3-(2,2,2-trifluoroethyl)pyrrolidine hydrochloride, 95%, 2,5-Dimethyl-3-(2,2,2-trifluoroethyl)pyrrolidine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2,5-dimethyl-3-(2,2,2-trifluoroethyl)pyrrolidine;hydrochloride (CAS 1823577-84-9) is a chemical compound with the molecular formula C8H15ClF3N and a molecular weight of 217.66 g/mol. IUPAC name: 2,5-dimethyl-3-(2,2,2-trifluoroethyl)pyrrolidine;hydrochloride. InChIKey: PMIZGQXMIYQIIR-UHFFFAOYSA-N.
| Molecular formula | C8H15ClF3N |
|---|---|
| Molecular weight | 217.66 g/mol |
| IUPAC name | 2,5-dimethyl-3-(2,2,2-trifluoroethyl)pyrrolidine;hydrochloride |
| InChIKey | PMIZGQXMIYQIIR-UHFFFAOYSA-N |
| SMILES | CC1CC(C(N1)C)CC(F)(F)F.Cl |
Computed by PubChem (NCBI)