CAS 1376609-36-7 appears in our catalog under these names: Trans-(3-fluoro-piperidin-4-yl)methyl-carbamic acid tert-butyl ester, 95%, rel-tert-Butyl ((3S,4S)-3-fluoropiperidin-4-yl)(methyl)carbamate, 97%, trans-(3-fluoro-piperidin-4-yl)methyl-carbamic acid tert-butyl ester, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg, 500mg.
Tert-butyl N-[(3R,4R)-3-fluoropiperidin-4-yl]-N-methylcarbamate (CAS 1376609-36-7) is a chemical compound with the molecular formula C11H21FN2O2 and a molecular weight of 232.29 g/mol. IUPAC name: tert-butyl N-[(3R,4R)-3-fluoropiperidin-4-yl]-N-methylcarbamate. InChIKey: VGCKWWMMIKCCKU-RKDXNWHRSA-N.
| Molecular formula | C11H21FN2O2 |
|---|---|
| Molecular weight | 232.29 g/mol |
| IUPAC name | tert-butyl N-[(3R,4R)-3-fluoropiperidin-4-yl]-N-methylcarbamate |
| InChIKey | VGCKWWMMIKCCKU-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@@H]1CCNC[C@H]1F |
Computed by PubChem (NCBI)