CAS 2102408-86-4 is the registry number for tert-Butyl n-[(3r,4r)-4-fluoropiperidin-3-yl]-n-methylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
Tert-butyl N-[(3R,4R)-4-fluoropiperidin-3-yl]-N-methylcarbamate (CAS 2102408-86-4) is a chemical compound with the molecular formula C11H21FN2O2 and a molecular weight of 232.29 g/mol. IUPAC name: tert-butyl N-[(3R,4R)-4-fluoropiperidin-3-yl]-N-methylcarbamate. InChIKey: JDXULPYBAYEORK-RKDXNWHRSA-N.
| Molecular formula | C11H21FN2O2 |
|---|---|
| Molecular weight | 232.29 g/mol |
| IUPAC name | tert-butyl N-[(3R,4R)-4-fluoropiperidin-3-yl]-N-methylcarbamate |
| InChIKey | JDXULPYBAYEORK-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@@H]1CNCC[C@H]1F |
Computed by PubChem (NCBI)