CAS 1408076-00-5 is the registry number for (3S,4R)-Rel-4-(boc-amino)-3-fluoropiperidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
Tert-butyl N-[[(3R,4S)-3-fluoropiperidin-4-yl]methyl]carbamate (CAS 1408076-00-5) is a chemical compound with the molecular formula C11H21FN2O2 and a molecular weight of 232.29 g/mol. IUPAC name: tert-butyl N-[[(3R,4S)-3-fluoropiperidin-4-yl]methyl]carbamate. InChIKey: YFIXLOOYHRDQJF-IUCAKERBSA-N.
| Molecular formula | C11H21FN2O2 |
|---|---|
| Molecular weight | 232.29 g/mol |
| IUPAC name | tert-butyl N-[[(3R,4S)-3-fluoropiperidin-4-yl]methyl]carbamate |
| InChIKey | YFIXLOOYHRDQJF-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H]1CCNC[C@@H]1F |
Computed by PubChem (NCBI)