Products 137740-37-5
CAS 137740-37-5 appears in our catalog under these names: 1'-Oxpbufuralol HCl, Bufuralol Impurity 4, 1’-Oxobufuralol Hydrochloride. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone;hydrochloride (CAS 137740-37-5) is a chemical compound with the molecular formula C16H22ClNO3 and a molecular weight of 311.80 g/mol. IUPAC name: 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone;hydrochloride. InChIKey: AJRDATHVMCLZIL-UHFFFAOYSA-N.
| Molecular formula | C16H22ClNO3 |
|---|---|
| Molecular weight | 311.80 g/mol |
| IUPAC name | 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone;hydrochloride |
| InChIKey | AJRDATHVMCLZIL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CC2=C1OC(=C2)C(CNC(C)(C)C)O.Cl |
Computed by PubChem (NCBI)