CAS 1219804-03-1 appears in our catalog under these names: 4–Hydroxypropranolol–d7 hydrochloride, 4-Hydroxy Propranolol-d7 HCl, rac-4-Hydroxy Propranolol-d7 Hydrochloride, >95% (HPLC), (±)-4-Hydroxypropranolol-d7 HCl (iso-propyl-d7), 99 atom % D, min 98% Chemical Purity, 4-Hydroxypropranolol-d7 hydrochloride. Offered by: GLPBio, Chemat Brand, TRC, CDN, TargetMol. Available pack sizes: 1mg, on request, 10mg, 0,01g, 0,005g, 5mg, 1 mg.
4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]naphthalen-1-ol;hydrochloride (CAS 1219804-03-1) is a chemical compound with the molecular formula C16H22ClNO3 and a molecular weight of 318.84 g/mol. IUPAC name: 4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]naphthalen-1-ol;hydrochloride. InChIKey: ROUJENUXWIFONU-BGKGEVRXSA-N.
| Molecular formula | C16H22ClNO3 |
|---|---|
| Molecular weight | 318.84 g/mol |
| IUPAC name | 4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]naphthalen-1-ol;hydrochloride |
| InChIKey | ROUJENUXWIFONU-BGKGEVRXSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(COC1=CC=C(C2=CC=CC=C21)O)O.Cl |
Computed by PubChem (NCBI)