Products 637-21-8
CAS 637-21-8 appears in our catalog under these names: Homatropine hydrochloride, 98%, Homatropine Hydrochloride, Homatropine Hydrochloride, >98.0%(HPLC), Homatropine Hydrochloride, 98.0%, 98.0%, Homatropine (hydrochloride). Offered by: Combi-blocks, TRC, Mikromol, LoGiCal, TCI. Available pack sizes: 25g, 1g, 5g, 2,5g, 250mg, 500mg, 100mg, 10mg.
[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-hydroxy-2-phenylacetate;hydrochloride (CAS 637-21-8) is a chemical compound with the molecular formula C16H22ClNO3 and a molecular weight of 311.80 g/mol. IUPAC name: [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-hydroxy-2-phenylacetate;hydrochloride. InChIKey: FRMDDIJBLQNNTC-MOTQWOLNSA-N.
| Molecular formula | C16H22ClNO3 |
|---|---|
| Molecular weight | 311.80 g/mol |
| IUPAC name | [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-hydroxy-2-phenylacetate;hydrochloride |
| InChIKey | FRMDDIJBLQNNTC-MOTQWOLNSA-N |
| SMILES | CN1[C@@H]2CC[C@H]1CC(C2)OC(=O)C(C3=CC=CC=C3)O.Cl |
Computed by PubChem (NCBI)