CAS 137787-00-9 appears in our catalog under these names: Boeravinone E, 98+%, Boeravinone E, Boeravinone E, 96.0%, 96.0%, Boeravinone E, 99.73%. Offered by: AmBeed, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 50mg, 25mg, 1 mg.
3,6,9,11-tetrahydroxy-10-methyl-6H-chromeno[3,4-b]chromen-12-one (CAS 137787-00-9) is a chemical compound with the molecular formula C17H12O7 and a molecular weight of 328.27 g/mol. IUPAC name: 3,6,9,11-tetrahydroxy-10-methyl-6H-chromeno[3,4-b]chromen-12-one. InChIKey: NCWLTPKGFNPAMP-UHFFFAOYSA-N.
| Molecular formula | C17H12O7 |
|---|---|
| Molecular weight | 328.27 g/mol |
| IUPAC name | 3,6,9,11-tetrahydroxy-10-methyl-6H-chromeno[3,4-b]chromen-12-one |
| InChIKey | NCWLTPKGFNPAMP-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1O)OC3=C(C2=O)C4=C(C=C(C=C4)O)OC3O)O |
Computed by PubChem (NCBI)