CAS 1449384-21-7 is the registry number for Boeravinone O. Offered by: MedChemExpress. Available pack sizes: Get quote.
4,6,11-trihydroxy-9-methoxy-6H-chromeno[3,4-b]chromen-12-one (CAS 1449384-21-7) is a chemical compound with the molecular formula C17H12O7 and a molecular weight of 328.27 g/mol. IUPAC name: 4,6,11-trihydroxy-9-methoxy-6H-chromeno[3,4-b]chromen-12-one. InChIKey: HIHQFLYPSJTPSM-UHFFFAOYSA-N.
| Molecular formula | C17H12O7 |
|---|---|
| Molecular weight | 328.27 g/mol |
| IUPAC name | 4,6,11-trihydroxy-9-methoxy-6H-chromeno[3,4-b]chromen-12-one |
| InChIKey | HIHQFLYPSJTPSM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=C1)OC3=C(C2=O)C4=C(C(=CC=C4)O)OC3O)O |
Computed by PubChem (NCBI)