CAS 1616592-62-1 is the registry number for Erythrinin H. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,8-dihydroxy-1,9-dimethoxy-[1]benzofuro[2,3-b]chromen-11-one (CAS 1616592-62-1) is a chemical compound with the molecular formula C17H12O7 and a molecular weight of 328.27 g/mol. IUPAC name: 3,8-dihydroxy-1,9-dimethoxy-[1]benzofuro[2,3-b]chromen-11-one. InChIKey: KYWPNBDUOWOKKV-UHFFFAOYSA-N.
| Molecular formula | C17H12O7 |
|---|---|
| Molecular weight | 328.27 g/mol |
| IUPAC name | 3,8-dihydroxy-1,9-dimethoxy-[1]benzofuro[2,3-b]chromen-11-one |
| InChIKey | KYWPNBDUOWOKKV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC2=C1C(=O)C3=C(O2)OC4=CC(=C(C=C43)OC)O)O |
Computed by PubChem (NCBI)