Products 137832-55-4

CAS 137832-55-4 is the registry number for 2-Chloropropane-1,1,1-d3, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.

Structural formula: {0} (CAS {1})

2-chloro-1,1,1-trideuteriopropane (CAS 137832-55-4) is a chemical compound with the molecular formula C3H7Cl and a molecular weight of 81.56 g/mol. IUPAC name: 2-chloro-1,1,1-trideuteriopropane. InChIKey: ULYZAYCEDJDHCC-FIBGUPNXSA-N.

Identity
Molecular formulaC3H7Cl
Molecular weight81.56 g/mol
IUPAC name2-chloro-1,1,1-trideuteriopropane
InChIKeyULYZAYCEDJDHCC-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])C(C)Cl

Computed by PubChem (NCBI)