Products 23197-02-6

CAS 23197-02-6 is the registry number for 2-Chloropropane-1,1,1,3,3,3-d6, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

2-chloro-1,1,1,3,3,3-hexadeuteriopropane (CAS 23197-02-6) is a chemical compound with the molecular formula C3H7Cl and a molecular weight of 84.58 g/mol. IUPAC name: 2-chloro-1,1,1,3,3,3-hexadeuteriopropane. InChIKey: ULYZAYCEDJDHCC-WFGJKAKNSA-N.

Identity
Molecular formulaC3H7Cl
Molecular weight84.58 g/mol
IUPAC name2-chloro-1,1,1,3,3,3-hexadeuteriopropane
InChIKeyULYZAYCEDJDHCC-WFGJKAKNSA-N
SMILES[2H]C([2H])([2H])C(C([2H])([2H])[2H])Cl

Computed by PubChem (NCBI)