CAS 23197-02-6 is the registry number for 2-Chloropropane-1,1,1,3,3,3-d6, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 5g, 1g.
2-chloro-1,1,1,3,3,3-hexadeuteriopropane (CAS 23197-02-6) is a chemical compound with the molecular formula C3H7Cl and a molecular weight of 84.58 g/mol. IUPAC name: 2-chloro-1,1,1,3,3,3-hexadeuteriopropane. InChIKey: ULYZAYCEDJDHCC-WFGJKAKNSA-N.
| Molecular formula | C3H7Cl |
|---|---|
| Molecular weight | 84.58 g/mol |
| IUPAC name | 2-chloro-1,1,1,3,3,3-hexadeuteriopropane |
| InChIKey | ULYZAYCEDJDHCC-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])Cl |
Computed by PubChem (NCBI)