CAS 55956-02-0 is the registry number for 2-Chloropropane-d7, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 5g.
2-chloro-1,1,1,2,3,3,3-heptadeuteriopropane (CAS 55956-02-0) is a chemical compound with the molecular formula C3H7Cl and a molecular weight of 85.58 g/mol. IUPAC name: 2-chloro-1,1,1,2,3,3,3-heptadeuteriopropane. InChIKey: ULYZAYCEDJDHCC-YYWVXINBSA-N.
| Molecular formula | C3H7Cl |
|---|---|
| Molecular weight | 85.58 g/mol |
| IUPAC name | 2-chloro-1,1,1,2,3,3,3-heptadeuteriopropane |
| InChIKey | ULYZAYCEDJDHCC-YYWVXINBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])Cl |
Computed by PubChem (NCBI)