Products 55956-02-0

CAS 55956-02-0 is the registry number for 2-Chloropropane-d7, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2-chloro-1,1,1,2,3,3,3-heptadeuteriopropane (CAS 55956-02-0) is a chemical compound with the molecular formula C3H7Cl and a molecular weight of 85.58 g/mol. IUPAC name: 2-chloro-1,1,1,2,3,3,3-heptadeuteriopropane. InChIKey: ULYZAYCEDJDHCC-YYWVXINBSA-N.

Identity
Molecular formulaC3H7Cl
Molecular weight85.58 g/mol
IUPAC name2-chloro-1,1,1,2,3,3,3-heptadeuteriopropane
InChIKeyULYZAYCEDJDHCC-YYWVXINBSA-N
SMILES[2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])Cl

Computed by PubChem (NCBI)