Products 1378524-25-4
CAS 1378524-25-4 is the registry number for PF-03671148. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-methyl-6-[2-(6-methyl-2-pyridinyl)pyrazol-3-yl]quinazolin-4-one (CAS 1378524-25-4) is a chemical compound with the molecular formula C18H15N5O and a molecular weight of 317.3 g/mol. IUPAC name: 3-methyl-6-[2-(6-methyl-2-pyridinyl)pyrazol-3-yl]quinazolin-4-one. InChIKey: OWIYYKSTVQMPLM-UHFFFAOYSA-N.
| Molecular formula | C18H15N5O |
|---|---|
| Molecular weight | 317.3 g/mol |
| IUPAC name | 3-methyl-6-[2-(6-methyl-2-pyridinyl)pyrazol-3-yl]quinazolin-4-one |
| InChIKey | OWIYYKSTVQMPLM-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)N2C(=CC=N2)C3=CC4=C(C=C3)N=CN(C4=O)C |
Computed by PubChem (NCBI)