CAS 1378742-65-4 is the registry number for 2-Formyl-4,5-dimethylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-formyl-4,5-dimethylbenzoic acid (CAS 1378742-65-4) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 2-formyl-4,5-dimethylbenzoic acid. InChIKey: QKESAYLQLSDZPK-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 2-formyl-4,5-dimethylbenzoic acid |
| InChIKey | QKESAYLQLSDZPK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)C(=O)O)C=O |
Computed by PubChem (NCBI)