Products 1378742-65-4

CAS 1378742-65-4 is the registry number for 2-Formyl-4,5-dimethylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-formyl-4,5-dimethylbenzoic acid (CAS 1378742-65-4) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 2-formyl-4,5-dimethylbenzoic acid. InChIKey: QKESAYLQLSDZPK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10O3
Molecular weight178.18 g/mol
IUPAC name2-formyl-4,5-dimethylbenzoic acid
InChIKeyQKESAYLQLSDZPK-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1C)C(=O)O)C=O

Computed by PubChem (NCBI)