CAS 1378847-51-8 appears in our catalog under these names: Fmoc-(2r,4r)-4-azidoproline, 95%, Fmoc-D-Pro(4-N3)-OH (2R,4R), (2R,4R)-4-Azido-1-{((9H-fluoren-9-yl)methoxy)carbonyl}pyrrolidine-2-carboxylic acid, Fmoc-(2R,4R)-D-Pro(4-N3)-OH 95%, (2R,4R)-Fmoc-D-Pro(4-N3)-OH. Offered by: Combi-blocks, Iris Biotech, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 5g, 500mg, 0,5g, 50mg, 50 mg.
(2R,4R)-4-azido-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS 1378847-51-8) is a chemical compound with the molecular formula C20H18N4O4 and a molecular weight of 378.4 g/mol. IUPAC name: (2R,4R)-4-azido-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid. InChIKey: HOPXMBBEYJTPNX-KZULUSFZSA-N.
| Molecular formula | C20H18N4O4 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | (2R,4R)-4-azido-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid |
| InChIKey | HOPXMBBEYJTPNX-KZULUSFZSA-N |
| SMILES | C1[C@H](CN([C@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)N=[N+]=[N-] |
Computed by PubChem (NCBI)