Products 943918-76-1
CAS 943918-76-1 is the registry number for 2-{4-(({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)methyl)-1H-1,2,3-triazol-1-yl}acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]triazol-1-yl]acetic acid (CAS 943918-76-1) is a chemical compound with the molecular formula C20H18N4O4 and a molecular weight of 378.4 g/mol. IUPAC name: 2-[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]triazol-1-yl]acetic acid. InChIKey: GOPNHTQASZJISG-UHFFFAOYSA-N.
| Molecular formula | C20H18N4O4 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 2-[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]triazol-1-yl]acetic acid |
| InChIKey | GOPNHTQASZJISG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC4=CN(N=N4)CC(=O)O |
Computed by PubChem (NCBI)