CAS 702679-55-8 appears in our catalog under these names: Fmoc-(2s,4r)-4-azidoproline, 98%, Fmoc-L-Pro(4-N3)-OH (2S,4R), (2S,4R)-4-azido-1-{((9H-fluoren-9-yl)methoxy)carbonyl}pyrrolidine-2-carboxylic acid, (2S,4R)-Fmoc-L-Pro(4-N3)-OH, 98.67%, Fmoc-L-4-azidoproline (2S, 4R), PEPTIPURE® min. 98 %, for biochemistry, 100 mg. Offered by: Combi-blocks, Iris Biotech, Biosynth, MedChemExpress, Roth. Available pack sizes: 1g, 100mg, 5g, 250mg, 500mg, 0,05g, 0,1g, 0,25g.
(2S,4R)-4-azido-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS 702679-55-8) is a chemical compound with the molecular formula C20H18N4O4 and a molecular weight of 378.4 g/mol. IUPAC name: (2S,4R)-4-azido-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid. InChIKey: HOPXMBBEYJTPNX-XIKOKIGWSA-N.
| Molecular formula | C20H18N4O4 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | (2S,4R)-4-azido-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid |
| InChIKey | HOPXMBBEYJTPNX-XIKOKIGWSA-N |
| SMILES | C1[C@H](CN([C@@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)N=[N+]=[N-] |
Computed by PubChem (NCBI)