Products 1378873-30-3
CAS 1378873-30-3 appears in our catalog under these names: 2-Amino-6-bromo-4-methoxy-benzoic Acid, 2-Amino-6-bromo-4-methoxybenzoic acid. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 0,5g, 50mg.
2-amino-6-bromo-4-methoxybenzoic acid (CAS 1378873-30-3) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 2-amino-6-bromo-4-methoxybenzoic acid. InChIKey: JNQFNEUXEYCXLK-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 2-amino-6-bromo-4-methoxybenzoic acid |
| InChIKey | JNQFNEUXEYCXLK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Br)C(=O)O)N |
Computed by PubChem (NCBI)