CAS 1379248-86-8 is the registry number for 5-Chloro-6-methylthiazolo[5,4-b]pyridin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-6-methyl-[1,3]thiazolo[5,4-b]pyridin-2-amine (CAS 1379248-86-8) is a chemical compound with the molecular formula C7H6ClN3S and a molecular weight of 199.66 g/mol. IUPAC name: 5-chloro-6-methyl-[1,3]thiazolo[5,4-b]pyridin-2-amine. InChIKey: PJBJMPXREAFNSZ-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3S |
|---|---|
| Molecular weight | 199.66 g/mol |
| IUPAC name | 5-chloro-6-methyl-[1,3]thiazolo[5,4-b]pyridin-2-amine |
| InChIKey | PJBJMPXREAFNSZ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N=C1Cl)SC(=N2)N |
Computed by PubChem (NCBI)