Products 502133-09-7
CAS 502133-09-7 appears in our catalog under these names: 3-(5-Chlorothiophen-2-yl)-1h-pyrazol-5-amine, 95%, 5-(5-Chlorothiophen-2-yl)-1H-pyrazol-3-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
5-(5-chlorothiophen-2-yl)-1H-pyrazol-3-amine (CAS 502133-09-7) is a chemical compound with the molecular formula C7H6ClN3S and a molecular weight of 199.66 g/mol. IUPAC name: 5-(5-chlorothiophen-2-yl)-1H-pyrazol-3-amine. InChIKey: QVOHWTUHWAZFDM-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3S |
|---|---|
| Molecular weight | 199.66 g/mol |
| IUPAC name | 5-(5-chlorothiophen-2-yl)-1H-pyrazol-3-amine |
| InChIKey | QVOHWTUHWAZFDM-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Cl)C2=CC(=NN2)N |
Computed by PubChem (NCBI)