CAS 453557-78-3 is the registry number for 2-Chloro-5-(1h-pyrazol-1-ylmethyl)-1,3-thiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-chloro-5-(pyrazol-1-ylmethyl)-1,3-thiazole (CAS 453557-78-3) is a chemical compound with the molecular formula C7H6ClN3S and a molecular weight of 199.66 g/mol. IUPAC name: 2-chloro-5-(pyrazol-1-ylmethyl)-1,3-thiazole. InChIKey: ZVHDRAJISDUITG-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3S |
|---|---|
| Molecular weight | 199.66 g/mol |
| IUPAC name | 2-chloro-5-(pyrazol-1-ylmethyl)-1,3-thiazole |
| InChIKey | ZVHDRAJISDUITG-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)CC2=CN=C(S2)Cl |
Computed by PubChem (NCBI)