CAS 1379285-83-2 is the registry number for 5-Methylbenzo[d]thiazole-2-carbaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-1,3-benzothiazole-2-carbaldehyde (CAS 1379285-83-2) is a chemical compound with the molecular formula C9H7NOS and a molecular weight of 177.22 g/mol. IUPAC name: 5-methyl-1,3-benzothiazole-2-carbaldehyde. InChIKey: UFTPERVCLGXNNM-UHFFFAOYSA-N.
| Molecular formula | C9H7NOS |
|---|---|
| Molecular weight | 177.22 g/mol |
| IUPAC name | 5-methyl-1,3-benzothiazole-2-carbaldehyde |
| InChIKey | UFTPERVCLGXNNM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)SC(=N2)C=O |
Computed by PubChem (NCBI)