CAS 1379303-06-6 appears in our catalog under these names: 3,4,5-Tribromo-2,6-dimethylpyridine, 95%, 3,4,5-Tribromo-2,6-dimethylpyridine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
3,4,5-tribromo-2,6-dimethylpyridine (CAS 1379303-06-6) is a chemical compound with the molecular formula C7H6Br3N and a molecular weight of 343.84 g/mol. IUPAC name: 3,4,5-tribromo-2,6-dimethylpyridine. InChIKey: QCUFRRICNUMXQC-UHFFFAOYSA-N.
| Molecular formula | C7H6Br3N |
|---|---|
| Molecular weight | 343.84 g/mol |
| IUPAC name | 3,4,5-tribromo-2,6-dimethylpyridine |
| InChIKey | QCUFRRICNUMXQC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)C)Br)Br)Br |
Computed by PubChem (NCBI)