CAS 5006-58-6 is the registry number for 2,3,5-Tribromo-4,6-dimethylpyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,3,5-tribromo-4,6-dimethylpyridine (CAS 5006-58-6) is a chemical compound with the molecular formula C7H6Br3N and a molecular weight of 343.84 g/mol. IUPAC name: 2,3,5-tribromo-4,6-dimethylpyridine. InChIKey: MPTZAZNRFRQFTO-UHFFFAOYSA-N.
| Molecular formula | C7H6Br3N |
|---|---|
| Molecular weight | 343.84 g/mol |
| IUPAC name | 2,3,5-tribromo-4,6-dimethylpyridine |
| InChIKey | MPTZAZNRFRQFTO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=C1Br)Br)C)Br |
Computed by PubChem (NCBI)