CAS 71642-16-5 appears in our catalog under these names: 3-Methyl-2,4,6-tribromoaniline/ 98+%, 3-Amino-2,4,6-tribromotoluene. Offered by: Chemat, Biosynth. Available pack sizes: 25g, 50g.
2,4,6-tribromo-3-methylaniline (CAS 71642-16-5) is a chemical compound with the molecular formula C7H6Br3N and a molecular weight of 343.84 g/mol. IUPAC name: 2,4,6-tribromo-3-methylaniline. InChIKey: KDZKZKWJNMBNAP-UHFFFAOYSA-N.
| Molecular formula | C7H6Br3N |
|---|---|
| Molecular weight | 343.84 g/mol |
| IUPAC name | 2,4,6-tribromo-3-methylaniline |
| InChIKey | KDZKZKWJNMBNAP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1Br)Br)N)Br |
Computed by PubChem (NCBI)