Products 1379305-67-5
CAS 1379305-67-5 appears in our catalog under these names: 5-Bromo-2-ethoxyisonicotinic acid, 98%, 5-BROMO-2-ETHOXYISONICOTINIC ACID, 97%, 5-Bromo-2-ethoxy iso nicotinic acid, 95%, 5-Bromo-2-ethoxy iso nicotinic acid, 97%, 97%. Offered by: AmBeed, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g, 25g.
5-bromo-2-ethoxypyridine-4-carboxylic acid (CAS 1379305-67-5) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 5-bromo-2-ethoxypyridine-4-carboxylic acid. InChIKey: QXZUYOLHQYEFFP-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 5-bromo-2-ethoxypyridine-4-carboxylic acid |
| InChIKey | QXZUYOLHQYEFFP-UHFFFAOYSA-N |
| SMILES | CCOC1=NC=C(C(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)