CAS 1379322-22-1 is the registry number for 4-Chloro-7-iodo-5H-pyrrolo[3,2-d]pyrimidin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-7-iodo-5H-pyrrolo[3,2-d]pyrimidin-2-amine (CAS 1379322-22-1) is a chemical compound with the molecular formula C6H4ClIN4 and a molecular weight of 294.48 g/mol. IUPAC name: 4-chloro-7-iodo-5H-pyrrolo[3,2-d]pyrimidin-2-amine. InChIKey: RMLDWQGXCUKQHP-UHFFFAOYSA-N.
| Molecular formula | C6H4ClIN4 |
|---|---|
| Molecular weight | 294.48 g/mol |
| IUPAC name | 4-chloro-7-iodo-5H-pyrrolo[3,2-d]pyrimidin-2-amine |
| InChIKey | RMLDWQGXCUKQHP-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(N1)C(=NC(=N2)N)Cl)I |
Computed by PubChem (NCBI)