Products 2097358-10-4
CAS 2097358-10-4 appears in our catalog under these names: 6-Chloro-3-iodoimidazo[1,2-b]pyridazin-2-amine, 97%, 97%, 6-Chloro-3-iodoimidazo[1,2-b]pyridazin-2-amine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
6-chloro-3-iodoimidazo[1,2-b]pyridazin-2-amine (CAS 2097358-10-4) is a chemical compound with the molecular formula C6H4ClIN4 and a molecular weight of 294.48 g/mol. IUPAC name: 6-chloro-3-iodoimidazo[1,2-b]pyridazin-2-amine. InChIKey: PSOXJAZDZSYOBI-UHFFFAOYSA-N.
| Molecular formula | C6H4ClIN4 |
|---|---|
| Molecular weight | 294.48 g/mol |
| IUPAC name | 6-chloro-3-iodoimidazo[1,2-b]pyridazin-2-amine |
| InChIKey | PSOXJAZDZSYOBI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NN2C1=NC(=C2I)N)Cl |
Computed by PubChem (NCBI)