CAS 2766312-12-1 appears in our catalog under these names: 6-Chloro-3-iodo-1-methyl-1H-pyrazolo(3,4-d)pyrimidine, 98%, 6-Chloro-3-iodo-1-methyl-1H-pyrazolo[3,4-d]pyrimidine, 98%, 98%, 6-Chloro-3-iodo-1-methyl-1H-pyrazolo[3,4-d]pyrimidine, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
6-chloro-3-iodo-1-methylpyrazolo[3,4-d]pyrimidine (CAS 2766312-12-1) is a chemical compound with the molecular formula C6H4ClIN4 and a molecular weight of 294.48 g/mol. IUPAC name: 6-chloro-3-iodo-1-methylpyrazolo[3,4-d]pyrimidine. InChIKey: SOALTTILXWWDLI-UHFFFAOYSA-N.
| Molecular formula | C6H4ClIN4 |
|---|---|
| Molecular weight | 294.48 g/mol |
| IUPAC name | 6-chloro-3-iodo-1-methylpyrazolo[3,4-d]pyrimidine |
| InChIKey | SOALTTILXWWDLI-UHFFFAOYSA-N |
| SMILES | CN1C2=NC(=NC=C2C(=N1)I)Cl |
Computed by PubChem (NCBI)