CAS 1379327-82-8 appears in our catalog under these names: 1-(2,6-Dimethylphenyl)-2,2,2-trifluoroethan-1-ol, 98%, 1-(2,6-Dimethylphenyl)-2,2,2-trifluoroethan-1-ol, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
1-(2,6-dimethylphenyl)-2,2,2-trifluoroethanol (CAS 1379327-82-8) is a chemical compound with the molecular formula C10H11F3O and a molecular weight of 204.19 g/mol. IUPAC name: 1-(2,6-dimethylphenyl)-2,2,2-trifluoroethanol. InChIKey: PEQGZZCTWOHNBC-UHFFFAOYSA-N.
| Molecular formula | C10H11F3O |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 1-(2,6-dimethylphenyl)-2,2,2-trifluoroethanol |
| InChIKey | PEQGZZCTWOHNBC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)C(C(F)(F)F)O |
Computed by PubChem (NCBI)