Products 1379342-46-7

CAS 1379342-46-7 is the registry number for Topiroxostat Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2-carbamoylpyridine-4-carboxylate (CAS 1379342-46-7) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: methyl 2-carbamoylpyridine-4-carboxylate. InChIKey: YSNHRNLOZCAXBF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8N2O3
Molecular weight180.16 g/mol
IUPAC namemethyl 2-carbamoylpyridine-4-carboxylate
InChIKeyYSNHRNLOZCAXBF-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=NC=C1)C(=O)N

Computed by PubChem (NCBI)