CAS 1379351-42-4 appears in our catalog under these names: 2-Amino-1-ethyl-1H-benzo(d)imidazole-5-carbonitrile, 97%, 2-Amino-1-ethyl-1H-1,3-benzodiazole-5-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-amino-1-ethylbenzimidazole-5-carbonitrile (CAS 1379351-42-4) is a chemical compound with the molecular formula C10H10N4 and a molecular weight of 186.21 g/mol. IUPAC name: 2-amino-1-ethylbenzimidazole-5-carbonitrile. InChIKey: AYDFJWBVRKLCCC-UHFFFAOYSA-N.
| Molecular formula | C10H10N4 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 2-amino-1-ethylbenzimidazole-5-carbonitrile |
| InChIKey | AYDFJWBVRKLCCC-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)C#N)N=C1N |
Computed by PubChem (NCBI)