CAS 13794-10-0 is the registry number for 2-(4-Nitrophenoxy)propanoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 25g, 5g.
2-(4-nitrophenoxy)propanoic acid (CAS 13794-10-0) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: 2-(4-nitrophenoxy)propanoic acid. InChIKey: OYYFEDUOOFSUGM-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 2-(4-nitrophenoxy)propanoic acid |
| InChIKey | OYYFEDUOOFSUGM-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)